C12H9F2N3 — CID 3482722
2,4-difluoro-N-(pyridin-3-ylmethylideneamino)aniline (PubChem CID 3482722) has the molecular formula C12H9F2N3 and a molecular weight of 233.22 g/mol. Its IUPAC name is 2,4-difluoro-N-(pyridin-3-ylmethylideneamino)aniline.
| Compound Name | 2,4-difluoro-N-(pyridin-3-ylmethylideneamino)aniline |
|---|---|
| PubChem CID | 3482722 |
| Molecular Formula | C12H9F2N3 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 2,4-difluoro-N-(pyridin-3-ylmethylideneamino)aniline |
| SMILES | Fc1ccc(NN=Cc2cccnc2)c(F)c1 |
| InChI | InChI=1S/C12H9F2N3/c13-10-3-4-12(11(14)6-10)17-16-8-9-2-1-5-15-7-9/h1-8,17H |
| InChIKey | DIJQLFUUDNHTBF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|