C15H11ClFN3O2S — CID 9145688
1-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-(4-fluorophenyl)thiourea (PubChem CID 9145688) has the molecular formula C15H11ClFN3O2S and a molecular weight of 351.79 g/mol. Its IUPAC name is 1-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9145688 |
| Molecular Formula | C15H11ClFN3O2S |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 1-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]-3-(4-fluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)N/N=C\c2cc(Cl)c3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C15H11ClFN3O2S/c16-12-5-9(6-13-14(12)22-8-21-13)7-18-20-15(23)19-11-3-1-10(17)2-4-11/h1-7H,8H2,(H2,19,20,23)/b18-7- |
| InChIKey | MIMBVPLSDISJSD-WSVATBPTSA-N |
| XLogP | 3.53 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|