C10H8ClNO5 — CID 77013491
2-[(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]oxyacetic acid (PubChem CID 77013491) has the molecular formula C10H8ClNO5 and a molecular weight of 257.63 g/mol. Its IUPAC name is 2-[(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]oxyacetic acid.
| Compound Name | 2-[(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 77013491 |
| Molecular Formula | C10H8ClNO5 |
| Molecular Weight | 257.63 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 2-[(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]oxyacetic acid |
| SMILES | O=C(O)CON=Cc1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C10H8ClNO5/c11-7-1-6(3-12-17-4-9(13)14)2-8-10(7)16-5-15-8/h1-3H,4-5H2,(H,13,14) |
| InChIKey | CJEBCBUBEMPYMY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.63 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|