C12H14Cl2N2O5S2 — CID 8842075
N'-(2,3-dichlorophenyl)sulfonyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide (PubChem CID 8842075) has the molecular formula C12H14Cl2N2O5S2 and a molecular weight of 401.29 g/mol. Its IUPAC name is N'-(2,3-dichlorophenyl)sulfonyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide.
| Compound Name | N'-(2,3-dichlorophenyl)sulfonyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 8842075 |
| Molecular Formula | C12H14Cl2N2O5S2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | N'-(2,3-dichlorophenyl)sulfonyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)NNS(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H14Cl2N2O5S2/c13-9-2-1-3-10(12(9)14)23(20,21)16-15-11(17)6-8-4-5-22(18,19)7-8/h1-3,8,16H,4-7H2,(H,15,17)/t8-/m0/s1 |
| InChIKey | DDYHCDOAXHIUFJ-QMMMGPOBSA-N |
| XLogP | 1.13 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|