C15H22N2O5S2 — CID 8842048
2-[(3S)-1,1-dioxothiolan-3-yl]-N'-(4-propan-2-ylphenyl)sulfonylacetohydrazide (PubChem CID 8842048) has the molecular formula C15H22N2O5S2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-[(3S)-1,1-dioxothiolan-3-yl]-N'-(4-propan-2-ylphenyl)sulfonylacetohydrazide.
| Compound Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-N'-(4-propan-2-ylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 8842048 |
| Molecular Formula | C15H22N2O5S2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-[(3S)-1,1-dioxothiolan-3-yl]-N'-(4-propan-2-ylphenyl)sulfonylacetohydrazide |
| SMILES | CC(C)c1ccc(S(=O)(=O)NNC(=O)C[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C15H22N2O5S2/c1-11(2)13-3-5-14(6-4-13)24(21,22)17-16-15(18)9-12-7-8-23(19,20)10-12/h3-6,11-12,17H,7-10H2,1-2H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | NJAXXBZQTYMWIF-GFCCVEGCSA-N |
| XLogP | 0.94 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|