C16H24N2O5S2 — CID 8842054
N'-[4-[(2R)-butan-2-yl]phenyl]sulfonyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide (PubChem CID 8842054) has the molecular formula C16H24N2O5S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N'-[4-[(2R)-butan-2-yl]phenyl]sulfonyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide.
| Compound Name | N'-[4-[(2R)-butan-2-yl]phenyl]sulfonyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 8842054 |
| Molecular Formula | C16H24N2O5S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N'-[4-[(2R)-butan-2-yl]phenyl]sulfonyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide |
| SMILES | CC[C@@H](C)c1ccc(S(=O)(=O)NNC(=O)C[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C16H24N2O5S2/c1-3-12(2)14-4-6-15(7-5-14)25(22,23)18-17-16(19)10-13-8-9-24(20,21)11-13/h4-7,12-13,18H,3,8-11H2,1-2H3,(H,17,19)/t12-,13+/m1/s1 |
| InChIKey | ARXPYTYLWJMIHM-OLZOCXBDSA-N |
| XLogP | 1.33 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|