C12H15ClN2O5S2 — CID 8842103
N'-(2-chlorophenyl)sulfonyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide (PubChem CID 8842103) has the molecular formula C12H15ClN2O5S2 and a molecular weight of 366.85 g/mol. Its IUPAC name is N'-(2-chlorophenyl)sulfonyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide.
| Compound Name | N'-(2-chlorophenyl)sulfonyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 8842103 |
| Molecular Formula | C12H15ClN2O5S2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | N'-(2-chlorophenyl)sulfonyl-2-[(3R)-1,1-dioxothiolan-3-yl]acetohydrazide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)NNS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C12H15ClN2O5S2/c13-10-3-1-2-4-11(10)22(19,20)15-14-12(16)7-9-5-6-21(17,18)8-9/h1-4,9,15H,5-8H2,(H,14,16)/t9-/m0/s1 |
| InChIKey | NJAAEJSGXIPOQL-VIFPVBQESA-N |
| XLogP | 0.47 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|