C15H21N3O7S3 — CID 42949070
N-cyclopropyl-4-[[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]sulfamoyl]benzenesulfonamide (PubChem CID 42949070) has the molecular formula C15H21N3O7S3 and a molecular weight of 451.55 g/mol. Its IUPAC name is N-cyclopropyl-4-[[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]sulfamoyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-[[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]sulfamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42949070 |
| Molecular Formula | C15H21N3O7S3 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | N-cyclopropyl-4-[[[2-(1,1-dioxothiolan-3-yl)acetyl]amino]sulfamoyl]benzenesulfonamide |
| SMILES | O=C(CC1CCS(=O)(=O)C1)NNS(=O)(=O)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C15H21N3O7S3/c19-15(9-11-7-8-26(20,21)10-11)16-18-28(24,25)14-5-3-13(4-6-14)27(22,23)17-12-1-2-12/h3-6,11-12,17-18H,1-2,7-10H2,(H,16,19) |
| InChIKey | LBWKYFMDQLUCCW-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|