C17H26N2O5S2 — CID 55428858
2-(1,1-dioxothiolan-3-yl)-N'-[4-(3-methylbutyl)phenyl]sulfonylacetohydrazide (PubChem CID 55428858) has the molecular formula C17H26N2O5S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N'-[4-(3-methylbutyl)phenyl]sulfonylacetohydrazide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N'-[4-(3-methylbutyl)phenyl]sulfonylacetohydrazide |
|---|---|
| PubChem CID | 55428858 |
| Molecular Formula | C17H26N2O5S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N'-[4-(3-methylbutyl)phenyl]sulfonylacetohydrazide |
| SMILES | CC(C)CCc1ccc(S(=O)(=O)NNC(=O)CC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H26N2O5S2/c1-13(2)3-4-14-5-7-16(8-6-14)26(23,24)19-18-17(20)11-15-9-10-25(21,22)12-15/h5-8,13,15,19H,3-4,9-12H2,1-2H3,(H,18,20) |
| InChIKey | LMFZCEJPEXKZEN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|