C16H18N4O5S2 — CID 40588060
2-[(3R)-1,1-dioxothiolan-3-yl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 40588060) has the molecular formula C16H18N4O5S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 40588060 |
| Molecular Formula | C16H18N4O5S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C16H18N4O5S2/c21-15(10-12-6-9-26(22,23)11-12)19-13-2-4-14(5-3-13)27(24,25)20-16-17-7-1-8-18-16/h1-5,7-8,12H,6,9-11H2,(H,19,21)(H,17,18,20)/t12-/m0/s1 |
| InChIKey | UONMKAXRFULQNA-LBPRGKRZSA-N |
| XLogP | 1.04 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |