C14H17Cl2NO3S — CID 55394808
N-[1-(3,4-dichlorophenyl)ethyl]-2-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 55394808) has the molecular formula C14H17Cl2NO3S and a molecular weight of 350.27 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-2-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-2-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 55394808 |
| Molecular Formula | C14H17Cl2NO3S |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-2-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CC(NC(=O)CC1CCS(=O)(=O)C1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2NO3S/c1-9(11-2-3-12(15)13(16)7-11)17-14(18)6-10-4-5-21(19,20)8-10/h2-3,7,9-10H,4-6,8H2,1H3,(H,17,18) |
| InChIKey | HPYOYGVNERHOOF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |