C12H15Cl2NO2S — CID 43082206
N-[1-(3,4-dichlorophenyl)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 43082206) has the molecular formula C12H15Cl2NO2S and a molecular weight of 308.23 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 43082206 |
| Molecular Formula | C12H15Cl2NO2S |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | CC(NC1CCS(=O)(=O)C1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO2S/c1-8(9-2-3-11(13)12(14)6-9)15-10-4-5-18(16,17)7-10/h2-3,6,8,10,15H,4-5,7H2,1H3 |
| InChIKey | WSUGNEVSWGCBSN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |