C18H25Cl2N — CID 43223783
N-[1-(3,4-dichlorophenyl)ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine (PubChem CID 43223783) has the molecular formula C18H25Cl2N and a molecular weight of 326.31 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 43223783 |
| Molecular Formula | C18H25Cl2N |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
| SMILES | CC(NC1CCC2CCCCC2C1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H25Cl2N/c1-12(14-7-9-17(19)18(20)11-14)21-16-8-6-13-4-2-3-5-15(13)10-16/h7,9,11-13,15-16,21H,2-6,8,10H2,1H3 |
| InChIKey | GOYISCHTINNXGP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |