C17H26N2 — CID 81406202
N-[(1S)-1-pyridin-4-ylethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine (PubChem CID 81406202) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N-[(1S)-1-pyridin-4-ylethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine.
| Compound Name | N-[(1S)-1-pyridin-4-ylethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 81406202 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N-[(1S)-1-pyridin-4-ylethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
| SMILES | C[C@H](NC1CCC2CCCCC2C1)c1ccncc1 |
| InChI | InChI=1S/C17H26N2/c1-13(14-8-10-18-11-9-14)19-17-7-6-15-4-2-3-5-16(15)12-17/h8-11,13,15-17,19H,2-7,12H2,1H3/t13-,15?,16?,17?/m0/s1 |
| InChIKey | YAWKPWYANXTUIL-AXTFLNQGSA-N |
| XLogP | 4.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |