C12H18N2 — CID 103562196
3-methyl-N-[(1S)-1-pyridin-4-ylethyl]cyclobutan-1-amine (PubChem CID 103562196) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 3-methyl-N-[(1S)-1-pyridin-4-ylethyl]cyclobutan-1-amine.
| Compound Name | 3-methyl-N-[(1S)-1-pyridin-4-ylethyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 103562196 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 3-methyl-N-[(1S)-1-pyridin-4-ylethyl]cyclobutan-1-amine |
| SMILES | CC1CC(N[C@@H](C)c2ccncc2)C1 |
| InChI | InChI=1S/C12H18N2/c1-9-7-12(8-9)14-10(2)11-3-5-13-6-4-11/h3-6,9-10,12,14H,7-8H2,1-2H3/t9?,10-,12?/m0/s1 |
| InChIKey | NKRVHDCVCURKIL-YZRBJQDESA-N |
| XLogP | 2.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |