C13H18ClN — CID 103562140
N-[(1R)-1-(4-chlorophenyl)ethyl]-3-methylcyclobutan-1-amine (PubChem CID 103562140) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)ethyl]-3-methylcyclobutan-1-amine.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-3-methylcyclobutan-1-amine |
|---|---|
| PubChem CID | 103562140 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)ethyl]-3-methylcyclobutan-1-amine |
| SMILES | CC1CC(N[C@H](C)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C13H18ClN/c1-9-7-13(8-9)15-10(2)11-3-5-12(14)6-4-11/h3-6,9-10,13,15H,7-8H2,1-2H3/t9?,10-,13?/m1/s1 |
| InChIKey | OWBOPJPCNAKDAF-RUETXSTFSA-N |
| XLogP | 3.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |