C18H19BrClN — CID 81349096
3-(4-bromophenyl)-N-[(1S)-1-(4-chlorophenyl)ethyl]cyclobutan-1-amine (PubChem CID 81349096) has the molecular formula C18H19BrClN and a molecular weight of 364.71 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-[(1S)-1-(4-chlorophenyl)ethyl]cyclobutan-1-amine.
| Compound Name | 3-(4-bromophenyl)-N-[(1S)-1-(4-chlorophenyl)ethyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 81349096 |
| Molecular Formula | C18H19BrClN |
| Molecular Weight | 364.71 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 3-(4-bromophenyl)-N-[(1S)-1-(4-chlorophenyl)ethyl]cyclobutan-1-amine |
| SMILES | C[C@H](NC1CC(c2ccc(Br)cc2)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19BrClN/c1-12(13-4-8-17(20)9-5-13)21-18-10-15(11-18)14-2-6-16(19)7-3-14/h2-9,12,15,18,21H,10-11H2,1H3/t12-,15?,18?/m0/s1 |
| InChIKey | DSEVPQHOTFDGFW-RTYYOJRZSA-N |
| XLogP | 5.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.71 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |