C11H14BrN — CID 30110346
N-[(1R)-1-(4-bromophenyl)ethyl]cyclopropanamine (PubChem CID 30110346) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromophenyl)ethyl]cyclopropanamine.
| Compound Name | N-[(1R)-1-(4-bromophenyl)ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 30110346 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | N-[(1R)-1-(4-bromophenyl)ethyl]cyclopropanamine |
| SMILES | C[C@@H](NC1CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H14BrN/c1-8(13-11-6-7-11)9-2-4-10(12)5-3-9/h2-5,8,11,13H,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | TXBVIKNBHAWCLX-MRVPVSSYSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |