C19H30BrN — CID 81356835
N-[(1S)-1-(4-bromophenyl)ethyl]-4-tert-butylcycloheptan-1-amine (PubChem CID 81356835) has the molecular formula C19H30BrN and a molecular weight of 352.36 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-4-tert-butylcycloheptan-1-amine.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-4-tert-butylcycloheptan-1-amine |
|---|---|
| PubChem CID | 81356835 |
| Molecular Formula | C19H30BrN |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-4-tert-butylcycloheptan-1-amine |
| SMILES | C[C@H](NC1CCCC(C(C)(C)C)CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H30BrN/c1-14(15-8-11-17(20)12-9-15)21-18-7-5-6-16(10-13-18)19(2,3)4/h8-9,11-12,14,16,18,21H,5-7,10,13H2,1-4H3/t14-,16?,18?/m0/s1 |
| InChIKey | RVCQDNARSUBWOJ-NXVRBGIVSA-N |
| XLogP | 6.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |