C15H19Cl2N — CID 112739956
(1R,6S)-N-[1-(3,4-dichlorophenyl)ethyl]bicyclo[4.1.0]heptan-2-amine (PubChem CID 112739956) has the molecular formula C15H19Cl2N and a molecular weight of 284.23 g/mol. Its IUPAC name is (1R,6S)-N-[1-(3,4-dichlorophenyl)ethyl]bicyclo[4.1.0]heptan-2-amine.
| Compound Name | (1R,6S)-N-[1-(3,4-dichlorophenyl)ethyl]bicyclo[4.1.0]heptan-2-amine |
|---|---|
| PubChem CID | 112739956 |
| Molecular Formula | C15H19Cl2N |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (1R,6S)-N-[1-(3,4-dichlorophenyl)ethyl]bicyclo[4.1.0]heptan-2-amine |
| SMILES | CC(NC1CCC[C@H]2C[C@@H]12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2N/c1-9(10-5-6-13(16)14(17)8-10)18-15-4-2-3-11-7-12(11)15/h5-6,8-9,11-12,15,18H,2-4,7H2,1H3/t9?,11-,12+,15?/m0/s1 |
| InChIKey | IAVSOJCYVBCRLV-BDVFFMEPSA-N |
| XLogP | 4.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |