C13H19NO3S — CID 81375776
N-[(1R)-1-(3-methoxyphenyl)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 81375776) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-[(1R)-1-(3-methoxyphenyl)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[(1R)-1-(3-methoxyphenyl)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 81375776 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-[(1R)-1-(3-methoxyphenyl)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | COc1cccc([C@@H](C)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H19NO3S/c1-10(11-4-3-5-13(8-11)17-2)14-12-6-7-18(15,16)9-12/h3-5,8,10,12,14H,6-7,9H2,1-2H3/t10-,12?/m1/s1 |
| InChIKey | NELZPHWYKBJSIR-RWANSRKNSA-N |
| XLogP | 1.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |