C13H18BrNO2S — CID 81381818
N-[(1R)-1-(3-bromophenyl)ethyl]-1,1-dioxothian-4-amine (PubChem CID 81381818) has the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. Its IUPAC name is N-[(1R)-1-(3-bromophenyl)ethyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[(1R)-1-(3-bromophenyl)ethyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 81381818 |
| Molecular Formula | C13H18BrNO2S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | N-[(1R)-1-(3-bromophenyl)ethyl]-1,1-dioxothian-4-amine |
| SMILES | C[C@@H](NC1CCS(=O)(=O)CC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H18BrNO2S/c1-10(11-3-2-4-12(14)9-11)15-13-5-7-18(16,17)8-6-13/h2-4,9-10,13,15H,5-8H2,1H3/t10-/m1/s1 |
| InChIKey | CSBGVPRHMKDLND-SNVBAGLBSA-N |
| XLogP | 2.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |