C14H18N2O4S — CID 43098081
6-[1-[(1,1-dioxothiolan-3-yl)amino]ethyl]-4H-1,4-benzoxazin-3-one (PubChem CID 43098081) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 6-[1-[(1,1-dioxothiolan-3-yl)amino]ethyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-[(1,1-dioxothiolan-3-yl)amino]ethyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43098081 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 6-[1-[(1,1-dioxothiolan-3-yl)amino]ethyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(NC1CCS(=O)(=O)C1)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H18N2O4S/c1-9(15-11-4-5-21(18,19)8-11)10-2-3-13-12(6-10)16-14(17)7-20-13/h2-3,6,9,11,15H,4-5,7-8H2,1H3,(H,16,17) |
| InChIKey | ODUYGGJSTWQXJJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |