C17H24N2O2 — CID 64907786
6-[1-[(2,3-dimethylcyclopentyl)amino]ethyl]-4H-1,4-benzoxazin-3-one (PubChem CID 64907786) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 6-[1-[(2,3-dimethylcyclopentyl)amino]ethyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-[(2,3-dimethylcyclopentyl)amino]ethyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 64907786 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 6-[1-[(2,3-dimethylcyclopentyl)amino]ethyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(NC1CCC(C)C1C)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C17H24N2O2/c1-10-4-6-14(11(10)2)18-12(3)13-5-7-16-15(8-13)19-17(20)9-21-16/h5,7-8,10-12,14,18H,4,6,9H2,1-3H3,(H,19,20) |
| InChIKey | WYJSWQZJICYIBY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |