C15H20N2O2S — CID 107165855
6-[1-(thiolan-3-ylmethylamino)ethyl]-4H-1,4-benzoxazin-3-one (PubChem CID 107165855) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 6-[1-(thiolan-3-ylmethylamino)ethyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-(thiolan-3-ylmethylamino)ethyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 107165855 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 6-[1-(thiolan-3-ylmethylamino)ethyl]-4H-1,4-benzoxazin-3-one |
| SMILES | CC(NCC1CCSC1)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C15H20N2O2S/c1-10(16-7-11-4-5-20-9-11)12-2-3-14-13(6-12)17-15(18)8-19-14/h2-3,6,10-11,16H,4-5,7-9H2,1H3,(H,17,18) |
| InChIKey | YEGKEDYBTKAKTD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |