C14H16N2O2 — CID 114415203
6-[1-(but-3-yn-2-ylamino)ethyl]-4H-1,4-benzoxazin-3-one (PubChem CID 114415203) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 6-[1-(but-3-yn-2-ylamino)ethyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[1-(but-3-yn-2-ylamino)ethyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 114415203 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 6-[1-(but-3-yn-2-ylamino)ethyl]-4H-1,4-benzoxazin-3-one |
| SMILES | C#CC(C)NC(C)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H16N2O2/c1-4-9(2)15-10(3)11-5-6-13-12(7-11)16-14(17)8-18-13/h1,5-7,9-10,15H,8H2,2-3H3,(H,16,17) |
| InChIKey | NFPOYQRKBKYESU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|