C13H14N2O3 — CID 166407009
N-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]prop-2-enamide (PubChem CID 166407009) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is N-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]prop-2-enamide.
| Compound Name | N-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166407009 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-[1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C13H14N2O3/c1-3-12(16)14-8(2)9-4-5-11-10(6-9)15-13(17)7-18-11/h3-6,8H,1,7H2,2H3,(H,14,16)(H,15,17) |
| InChIKey | SVNLHDKNRUMZAQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|