C14H19N3O4 — CID 94149101
1-(3-hydroxypropyl)-3-[(1S)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]urea (PubChem CID 94149101) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-[(1S)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]urea.
| Compound Name | 1-(3-hydroxypropyl)-3-[(1S)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]urea |
|---|---|
| PubChem CID | 94149101 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-[(1S)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]urea |
| SMILES | C[C@H](NC(=O)NCCCO)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H19N3O4/c1-9(16-14(20)15-5-2-6-18)10-3-4-12-11(7-10)17-13(19)8-21-12/h3-4,7,9,18H,2,5-6,8H2,1H3,(H,17,19)(H2,15,16,20)/t9-/m0/s1 |
| InChIKey | XVPZDWKYRGNNLY-VIFPVBQESA-N |
| XLogP | 0.76 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|