C21H21N3O3S — CID 135776758
2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]acetamide (PubChem CID 135776758) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135776758 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-[(3R)-1,1-dioxothiolan-3-yl]-N-[(E)-(2-phenyl-1H-indol-3-yl)methylideneamino]acetamide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)N/N=C/c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H21N3O3S/c25-20(12-15-10-11-28(26,27)14-15)24-22-13-18-17-8-4-5-9-19(17)23-21(18)16-6-2-1-3-7-16/h1-9,13,15,23H,10-12,14H2,(H,24,25)/b22-13+/t15-/m0/s1 |
| InChIKey | UDWLUVGCSSDVDR-NSMHLIOHSA-N |
| XLogP | 3.11 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|