C23H27N3O4 — CID 9237657
(3S)-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 9237657) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is (3S)-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 9237657 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (3S)-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)[C@@H]2COc3ccccc3O2)cc1CN1CCCC1 |
| InChI | InChI=1S/C23H27N3O4/c1-16(17-9-10-19(28-2)18(13-17)14-26-11-5-6-12-26)24-25-23(27)22-15-29-20-7-3-4-8-21(20)30-22/h3-4,7-10,13,22H,5-6,11-12,14-15H2,1-2H3,(H,25,27)/b24-16-/t22-/m0/s1 |
| InChIKey | DEOWFSLJHQFHCR-ZKFYFQMZSA-N |
| XLogP | 2.97 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|