C20H20F5N3O — CID 9466416
2,3,4,5,6-pentafluoro-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino]aniline (PubChem CID 9466416) has the molecular formula C20H20F5N3O and a molecular weight of 413.39 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino]aniline |
|---|---|
| PubChem CID | 9466416 |
| Molecular Formula | C20H20F5N3O |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(Z)-1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino]aniline |
| SMILES | COc1ccc(/C(C)=N\Nc2c(F)c(F)c(F)c(F)c2F)cc1CN1CCCC1 |
| InChI | InChI=1S/C20H20F5N3O/c1-11(26-27-20-18(24)16(22)15(21)17(23)19(20)25)12-5-6-14(29-2)13(9-12)10-28-7-3-4-8-28/h5-6,9,27H,3-4,7-8,10H2,1-2H3/b26-11- |
| InChIKey | WMHGVQWQPZHWGJ-RAWMCFOBSA-N |
| XLogP | 4.82 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|