C20H27N5O2 — CID 9013581
N-[(Z)-1-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]ethylideneamino]-4,6-dimethylpyrimidin-2-amine (PubChem CID 9013581) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[(Z)-1-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]ethylideneamino]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | N-[(Z)-1-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]ethylideneamino]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 9013581 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-[(Z)-1-[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]ethylideneamino]-4,6-dimethylpyrimidin-2-amine |
| SMILES | COc1ccc(/C(C)=N\Nc2nc(C)cc(C)n2)cc1CN1CCOCC1 |
| InChI | InChI=1S/C20H27N5O2/c1-14-11-15(2)22-20(21-14)24-23-16(3)17-5-6-19(26-4)18(12-17)13-25-7-9-27-10-8-25/h5-6,11-12H,7-10,13H2,1-4H3,(H,21,22,24)/b23-16- |
| InChIKey | HZPJBLFFMNGNDM-KQWNVCNZSA-N |
| XLogP | 2.77 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|