C12H17Cl2NO2 — CID 16682270
4-[(5-chloro-2-methoxyphenyl)methyl]morpholine;hydrochloride (PubChem CID 16682270) has the molecular formula C12H17Cl2NO2 and a molecular weight of 278.18 g/mol. Its IUPAC name is 4-[(5-chloro-2-methoxyphenyl)methyl]morpholine;hydrochloride.
| Compound Name | 4-[(5-chloro-2-methoxyphenyl)methyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 16682270 |
| Molecular Formula | C12H17Cl2NO2 |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 4-[(5-chloro-2-methoxyphenyl)methyl]morpholine;hydrochloride |
| SMILES | COc1ccc(Cl)cc1CN1CCOCC1.Cl |
| InChI | InChI=1S/C12H16ClNO2.ClH/c1-15-12-3-2-11(13)8-10(12)9-14-4-6-16-7-5-14;/h2-3,8H,4-7,9H2,1H3;1H |
| InChIKey | PXPTZYJQESXHME-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |