C15H22Cl2N2O — CID 63387973
1-(2-chloroethyl)-4-[(5-chloro-2-methoxyphenyl)methyl]-1,4-diazepane (PubChem CID 63387973) has the molecular formula C15H22Cl2N2O and a molecular weight of 317.26 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-[(5-chloro-2-methoxyphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-(2-chloroethyl)-4-[(5-chloro-2-methoxyphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 63387973 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-(2-chloroethyl)-4-[(5-chloro-2-methoxyphenyl)methyl]-1,4-diazepane |
| SMILES | COc1ccc(Cl)cc1CN1CCCN(CCCl)CC1 |
| InChI | InChI=1S/C15H22Cl2N2O/c1-20-15-4-3-14(17)11-13(15)12-19-7-2-6-18(8-5-16)9-10-19/h3-4,11H,2,5-10,12H2,1H3 |
| InChIKey | UHORKTDZYDDBDF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|