C21H23N3O5 — CID 2803621
[1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino] 4-nitrobenzoate (PubChem CID 2803621) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is [1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino] 4-nitrobenzoate.
| Compound Name | [1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino] 4-nitrobenzoate |
|---|---|
| PubChem CID | 2803621 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | [1-[4-methoxy-3-(pyrrolidin-1-ylmethyl)phenyl]ethylideneamino] 4-nitrobenzoate |
| SMILES | COc1ccc(C(C)=NOC(=O)c2ccc([N+](=O)[O-])cc2)cc1CN1CCCC1 |
| InChI | InChI=1S/C21H23N3O5/c1-15(22-29-21(25)16-5-8-19(9-6-16)24(26)27)17-7-10-20(28-2)18(13-17)14-23-11-3-4-12-23/h5-10,13H,3-4,11-12,14H2,1-2H3 |
| InChIKey | AJLBMOHRWZUQIT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|