C16H15Cl2NO — CID 22660922
N,N-bis[(4-chlorophenyl)methyl]acetamide (PubChem CID 22660922) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is N,N-bis[(4-chlorophenyl)methyl]acetamide.
| Compound Name | N,N-bis[(4-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 22660922 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | N,N-bis[(4-chlorophenyl)methyl]acetamide |
| SMILES | CC(=O)N(Cc1ccc(Cl)cc1)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO/c1-12(20)19(10-13-2-6-15(17)7-3-13)11-14-4-8-16(18)9-5-14/h2-9H,10-11H2,1H3 |
| InChIKey | YRPOODGUPMHJBF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |