C11H14Cl2N2O — CID 21398152
1-(chloromethyl)-1-[(4-chlorophenyl)methyl]-3,3-dimethylurea (PubChem CID 21398152) has the molecular formula C11H14Cl2N2O and a molecular weight of 261.15 g/mol. Its IUPAC name is 1-(chloromethyl)-1-[(4-chlorophenyl)methyl]-3,3-dimethylurea.
| Compound Name | 1-(chloromethyl)-1-[(4-chlorophenyl)methyl]-3,3-dimethylurea |
|---|---|
| PubChem CID | 21398152 |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1-(chloromethyl)-1-[(4-chlorophenyl)methyl]-3,3-dimethylurea |
| SMILES | CN(C)C(=O)N(CCl)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14Cl2N2O/c1-14(2)11(16)15(8-12)7-9-3-5-10(13)6-4-9/h3-6H,7-8H2,1-2H3 |
| InChIKey | GHQAVHAVPPHRKN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|