C10H13ClN4O2 — CID 144730892
(Z)-2,3-diamino-3-[amino-[(4-chlorophenyl)methyl]amino]prop-2-enoic acid (PubChem CID 144730892) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is (Z)-2,3-diamino-3-[amino-[(4-chlorophenyl)methyl]amino]prop-2-enoic acid.
| Compound Name | (Z)-2,3-diamino-3-[amino-[(4-chlorophenyl)methyl]amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 144730892 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (Z)-2,3-diamino-3-[amino-[(4-chlorophenyl)methyl]amino]prop-2-enoic acid |
| SMILES | N/C(C(=O)O)=C(/N)N(N)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H13ClN4O2/c11-7-3-1-6(2-4-7)5-15(14)9(13)8(12)10(16)17/h1-4H,5,12-14H2,(H,16,17)/b9-8- |
| InChIKey | QLTTZIZCFUXKOQ-HJWRWDBZSA-N |
| XLogP | 0.19 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|