C9H9ClN2O2 — CID 89286361
2-amino-2-[(4-chlorophenyl)methylimino]acetic acid (PubChem CID 89286361) has the molecular formula C9H9ClN2O2 and a molecular weight of 212.64 g/mol. Its IUPAC name is 2-amino-2-[(4-chlorophenyl)methylimino]acetic acid.
| Compound Name | 2-amino-2-[(4-chlorophenyl)methylimino]acetic acid |
|---|---|
| PubChem CID | 89286361 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 2-amino-2-[(4-chlorophenyl)methylimino]acetic acid |
| SMILES | N/C(=N\Cc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C9H9ClN2O2/c10-7-3-1-6(2-4-7)5-12-8(11)9(13)14/h1-4H,5H2,(H2,11,12)(H,13,14) |
| InChIKey | LDAZOBCEYYVSOW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|