C32H26Cl2N4O — CID 169205783
N'-[(4-chlorophenyl)methyl]-4-[5-[4-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]phenyl]furan-2-yl]benzenecarboximidamide (PubChem CID 169205783) has the molecular formula C32H26Cl2N4O and a molecular weight of 553.49 g/mol. Its IUPAC name is N'-[(4-chlorophenyl)methyl]-4-[5-[4-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]phenyl]furan-2-yl]benzenecarboximidamide.
| Compound Name | N'-[(4-chlorophenyl)methyl]-4-[5-[4-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]phenyl]furan-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 169205783 |
| Molecular Formula | C32H26Cl2N4O |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | N'-[(4-chlorophenyl)methyl]-4-[5-[4-[N'-[(4-chlorophenyl)methyl]carbamimidoyl]phenyl]furan-2-yl]benzenecarboximidamide |
| SMILES | N/C(=N\Cc1ccc(Cl)cc1)c1ccc(-c2ccc(-c3ccc(/C(N)=N/Cc4ccc(Cl)cc4)cc3)o2)cc1 |
| InChI | InChI=1S/C32H26Cl2N4O/c33-27-13-1-21(2-14-27)19-37-31(35)25-9-5-23(6-10-25)29-17-18-30(39-29)24-7-11-26(12-8-24)32(36)38-20-22-3-15-28(34)16-4-22/h1-18H,19-20H2,(H2,35,37)(H2,36,38) |
| InChIKey | LSTBGFIZOOWBJC-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|