C25H24N4O3 — CID 89033049
N'-ethyl-4-[5-[5-[4-[(Z)-N'-methoxycarbamimidoyl]phenyl]furan-2-yl]furan-2-yl]benzenecarboximidamide (PubChem CID 89033049) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is N'-ethyl-4-[5-[5-[4-[(Z)-N'-methoxycarbamimidoyl]phenyl]furan-2-yl]furan-2-yl]benzenecarboximidamide.
| Compound Name | N'-ethyl-4-[5-[5-[4-[(Z)-N'-methoxycarbamimidoyl]phenyl]furan-2-yl]furan-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 89033049 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | N'-ethyl-4-[5-[5-[4-[(Z)-N'-methoxycarbamimidoyl]phenyl]furan-2-yl]furan-2-yl]benzenecarboximidamide |
| SMILES | CC/N=C(\N)c1ccc(-c2ccc(-c3ccc(-c4ccc(/C(N)=N/OC)cc4)o3)o2)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-3-28-24(26)18-8-4-16(5-9-18)20-12-14-22(31-20)23-15-13-21(32-23)17-6-10-19(11-7-17)25(27)29-30-2/h4-15H,3H2,1-2H3,(H2,26,28)(H2,27,29) |
| InChIKey | XNQPHJRQYDYTKA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|