C24H24N4O7 — CID 5482488
[(E)-[amino-[4-[5-[4-[(E)-N'-ethoxycarbonyloxycarbamimidoyl]phenyl]furan-2-yl]phenyl]methylidene]amino] ethyl carbonate (PubChem CID 5482488) has the molecular formula C24H24N4O7 and a molecular weight of 480.48 g/mol. Its IUPAC name is [(E)-[amino-[4-[5-[4-[(E)-N'-ethoxycarbonyloxycarbamimidoyl]phenyl]furan-2-yl]phenyl]methylidene]amino] ethyl carbonate.
| Compound Name | [(E)-[amino-[4-[5-[4-[(E)-N'-ethoxycarbonyloxycarbamimidoyl]phenyl]furan-2-yl]phenyl]methylidene]amino] ethyl carbonate |
|---|---|
| PubChem CID | 5482488 |
| Molecular Formula | C24H24N4O7 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | [(E)-[amino-[4-[5-[4-[(E)-N'-ethoxycarbonyloxycarbamimidoyl]phenyl]furan-2-yl]phenyl]methylidene]amino] ethyl carbonate |
| SMILES | CCOC(=O)O/N=C(/N)c1ccc(-c2ccc(-c3ccc(/C(N)=N\OC(=O)OCC)cc3)o2)cc1 |
| InChI | InChI=1S/C24H24N4O7/c1-3-31-23(29)34-27-21(25)17-9-5-15(6-10-17)19-13-14-20(33-19)16-7-11-18(12-8-16)22(26)28-35-24(30)32-4-2/h5-14H,3-4H2,1-2H3,(H2,25,27)(H2,26,28) |
| InChIKey | NGCNSGHAJPIIPO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|