C34H28N4O7 — CID 6476093
(4-methoxyphenyl) (NE)-N-[amino-[4-[5-[4-[(E)-N'-(4-methoxyphenoxy)carbonylcarbamimidoyl]phenyl]furan-2-yl]phenyl]methylidene]carbamate (PubChem CID 6476093) has the molecular formula C34H28N4O7 and a molecular weight of 604.62 g/mol. Its IUPAC name is (4-methoxyphenyl) (NE)-N-[amino-[4-[5-[4-[(E)-N'-(4-methoxyphenoxy)carbonylcarbamimidoyl]phenyl]furan-2-yl]phenyl]methylidene]carbamate.
| Compound Name | (4-methoxyphenyl) (NE)-N-[amino-[4-[5-[4-[(E)-N'-(4-methoxyphenoxy)carbonylcarbamimidoyl]phenyl]furan-2-yl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 6476093 |
| Molecular Formula | C34H28N4O7 |
| Molecular Weight | 604.62 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | (4-methoxyphenyl) (NE)-N-[amino-[4-[5-[4-[(E)-N'-(4-methoxyphenoxy)carbonylcarbamimidoyl]phenyl]furan-2-yl]phenyl]methylidene]carbamate |
| SMILES | COc1ccc(OC(=O)/N=C(/N)c2ccc(-c3ccc(-c4ccc(/C(N)=N\C(=O)Oc5ccc(OC)cc5)cc4)o3)cc2)cc1 |
| InChI | InChI=1S/C34H28N4O7/c1-41-25-11-15-27(16-12-25)43-33(39)37-31(35)23-7-3-21(4-8-23)29-19-20-30(45-29)22-5-9-24(10-6-22)32(36)38-34(40)44-28-17-13-26(42-2)14-18-28/h3-20H,1-2H3,(H2,35,37,39)(H2,36,38,40) |
| InChIKey | QAFXGBFDDAWEFS-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|