C13H18N2O3 — CID 82480855
tert-butyl (NZ)-N-[amino-(4-methoxyphenyl)methylidene]carbamate (PubChem CID 82480855) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[amino-(4-methoxyphenyl)methylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[amino-(4-methoxyphenyl)methylidene]carbamate |
|---|---|
| PubChem CID | 82480855 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | tert-butyl (NZ)-N-[amino-(4-methoxyphenyl)methylidene]carbamate |
| SMILES | COc1ccc(/C(N)=N/C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C13H18N2O3/c1-13(2,3)18-12(16)15-11(14)9-5-7-10(17-4)8-6-9/h5-8H,1-4H3,(H2,14,15,16) |
| InChIKey | FXIHAAMXEMAVDG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|