C14H20N2O3 — CID 7057020
N-[(2S)-1-amino-2,3-dimethyl-1-oxobutan-2-yl]-4-methoxybenzamide (PubChem CID 7057020) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-[(2S)-1-amino-2,3-dimethyl-1-oxobutan-2-yl]-4-methoxybenzamide.
| Compound Name | N-[(2S)-1-amino-2,3-dimethyl-1-oxobutan-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 7057020 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-[(2S)-1-amino-2,3-dimethyl-1-oxobutan-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@](C)(C(N)=O)C(C)C)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-9(2)14(3,13(15)18)16-12(17)10-5-7-11(19-4)8-6-10/h5-9H,1-4H3,(H2,15,18)(H,16,17)/t14-/m0/s1 |
| InChIKey | LANKEUZRNWLGIX-AWEZNQCLSA-N |
| XLogP | 1.33 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |