C20H23N3O5 — CID 57198393
tert-butyl N-[amino-[4-[2-(4-nitrophenoxy)ethyl]phenyl]methylidene]carbamate (PubChem CID 57198393) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is tert-butyl N-[amino-[4-[2-(4-nitrophenoxy)ethyl]phenyl]methylidene]carbamate.
| Compound Name | tert-butyl N-[amino-[4-[2-(4-nitrophenoxy)ethyl]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 57198393 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | tert-butyl N-[amino-[4-[2-(4-nitrophenoxy)ethyl]phenyl]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(N)c1ccc(CCOc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H23N3O5/c1-20(2,3)28-19(24)22-18(21)15-6-4-14(5-7-15)12-13-27-17-10-8-16(9-11-17)23(25)26/h4-11H,12-13H2,1-3H3,(H2,21,22,24) |
| InChIKey | XDZBWQQTEWBEAZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|