C21H19N5O5 — CID 11069852
[(E)-[[4-[5-[6-[(E)-N'-acetyloxycarbamimidoyl]-3-pyridinyl]furan-2-yl]phenyl]-aminomethylidene]amino] acetate (PubChem CID 11069852) has the molecular formula C21H19N5O5 and a molecular weight of 421.41 g/mol. Its IUPAC name is [(E)-[[4-[5-[6-[(E)-N'-acetyloxycarbamimidoyl]-3-pyridinyl]furan-2-yl]phenyl]-aminomethylidene]amino] acetate.
| Compound Name | [(E)-[[4-[5-[6-[(E)-N'-acetyloxycarbamimidoyl]-3-pyridinyl]furan-2-yl]phenyl]-aminomethylidene]amino] acetate |
|---|---|
| PubChem CID | 11069852 |
| Molecular Formula | C21H19N5O5 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [(E)-[[4-[5-[6-[(E)-N'-acetyloxycarbamimidoyl]-3-pyridinyl]furan-2-yl]phenyl]-aminomethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(/N)c1ccc(-c2ccc(-c3ccc(/C(N)=N\OC(C)=O)nc3)o2)cc1 |
| InChI | InChI=1S/C21H19N5O5/c1-12(27)30-25-20(22)15-5-3-14(4-6-15)18-9-10-19(29-18)16-7-8-17(24-11-16)21(23)26-31-13(2)28/h3-11H,1-2H3,(H2,22,25)(H2,23,26) |
| InChIKey | BPEQRRZFVHTGRU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 155.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|