C22H24N8O3 — CID 58767878
2,5-bis(4-carbamimidoylphenyl)-3-N',4-N'-dimethoxyfuran-3,4-dicarboximidamide (PubChem CID 58767878) has the molecular formula C22H24N8O3 and a molecular weight of 448.49 g/mol. Its IUPAC name is 2,5-bis(4-carbamimidoylphenyl)-3-N',4-N'-dimethoxyfuran-3,4-dicarboximidamide.
| Compound Name | 2,5-bis(4-carbamimidoylphenyl)-3-N',4-N'-dimethoxyfuran-3,4-dicarboximidamide |
|---|---|
| PubChem CID | 58767878 |
| Molecular Formula | C22H24N8O3 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2,5-bis(4-carbamimidoylphenyl)-3-N',4-N'-dimethoxyfuran-3,4-dicarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(-c2oc(-c3ccc(/C(N)=N/[H])cc3)c(/C(N)=N\OC)c2C(N)=NOC)cc1 |
| InChI | InChI=1S/C22H24N8O3/c1-31-29-21(27)15-16(22(28)30-32-2)18(12-5-9-14(10-6-12)20(25)26)33-17(15)11-3-7-13(8-4-11)19(23)24/h3-10H,1-2H3,(H3,23,24)(H3,25,26)(H2,27,29)(H2,28,30) |
| InChIKey | VGMPJGIWWXQQOF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 208.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|