C22H22N4O2 — CID 58478039
N'-methoxy-4-[4-[4-[(Z)-N'-methoxycarbamimidoyl]phenyl]phenyl]benzenecarboximidamide (PubChem CID 58478039) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is N'-methoxy-4-[4-[4-[(Z)-N'-methoxycarbamimidoyl]phenyl]phenyl]benzenecarboximidamide.
| Compound Name | N'-methoxy-4-[4-[4-[(Z)-N'-methoxycarbamimidoyl]phenyl]phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 58478039 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N'-methoxy-4-[4-[4-[(Z)-N'-methoxycarbamimidoyl]phenyl]phenyl]benzenecarboximidamide |
| SMILES | CO/N=C(\N)c1ccc(-c2ccc(-c3ccc(/C(N)=N\OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H22N4O2/c1-27-25-21(23)19-11-7-17(8-12-19)15-3-5-16(6-4-15)18-9-13-20(14-10-18)22(24)26-28-2/h3-14H,1-2H3,(H2,23,25)(H2,24,26) |
| InChIKey | QZNNUWUFFBUTIG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|