C10H8Cl2O4 — CID 122378563
2-chloro-2-[(4-chlorophenyl)methyl]propanedioic acid (PubChem CID 122378563) has the molecular formula C10H8Cl2O4 and a molecular weight of 263.08 g/mol. Its IUPAC name is 2-chloro-2-[(4-chlorophenyl)methyl]propanedioic acid.
| Compound Name | 2-chloro-2-[(4-chlorophenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 122378563 |
| Molecular Formula | C10H8Cl2O4 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 2-chloro-2-[(4-chlorophenyl)methyl]propanedioic acid |
| SMILES | O=C(O)C(Cl)(Cc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C10H8Cl2O4/c11-7-3-1-6(2-4-7)5-10(12,8(13)14)9(15)16/h1-4H,5H2,(H,13,14)(H,15,16) |
| InChIKey | IRFXFSNHLWVIPC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|